ID | 2878 |
Name | Oxycodone |
Pubchem ID | 5284603 |
KEGG ID | D05312 |
Source | Derivative of Codeine |
Type | Unknown |
Function | Analgesic |
Drug Like Properties | Yes |
Molecular Weight | 315.36 |
Exact mass | 315.147058 |
Molecular formula | C18H21NO4 |
XlogP | 1.2 |
Topological Polar Surface Area | 59 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC23C4C(=O)CCC2(C1CC5=C3C(=C(C=C5)OC)O4)O |
Isomeric SMILE | CN1CC[C@]23[C@@H]4C(=O)CC[C@]2([C@H]1CC5=C3C(=C(C=C5)OC)O4)O |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2879 |
Name | Oxycodone |
Pubchem ID | 5464086 |
KEGG ID | N/A |
Source | Derivative of Codeine |
Type | Unknown |
Function | Analgesic |
Drug Like Properties | No |
Molecular Weight | 351.82 |
Exact mass | 351.123736 |
Molecular formula | C18H22ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 59 |
H-Bond Donor | 2 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC23C4C(=O)CCC2(C1CC5=C3C(=C(C=C5)OC)O4)O.Cl |
Isomeric SMILE | CN1CC[C@]23C4C(=O)CC[C@]2([C@H]1CC5=C3C(=C(C=C5)OC)O4)O.Cl |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |